C13H16F14N2O2 — CID 19043782
2,2-bis(1,1,2,2,3,4,4-heptafluorobutoxymethyl)propane-1,3-diamine (PubChem CID 19043782) has the molecular formula C13H16F14N2O2 and a molecular weight of 498.26 g/mol. Its IUPAC name is 2,2-bis(1,1,2,2,3,4,4-heptafluorobutoxymethyl)propane-1,3-diamine.
| Compound Name | 2,2-bis(1,1,2,2,3,4,4-heptafluorobutoxymethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 19043782 |
| Molecular Formula | C13H16F14N2O2 |
| Molecular Weight | 498.26 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 2,2-bis(1,1,2,2,3,4,4-heptafluorobutoxymethyl)propane-1,3-diamine |
| SMILES | NCC(CN)(COC(F)(F)C(F)(F)C(F)C(F)F)COC(F)(F)C(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C13H16F14N2O2/c14-5(7(16)17)10(20,21)12(24,25)30-3-9(1-28,2-29)4-31-13(26,27)11(22,23)6(15)8(18)19/h5-8H,1-4,28-29H2 |
| InChIKey | AWCRFTZTQJJLHH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|