About cyclohex-4-ene-1,2-diamine;hydrochloride
cyclohex-4-ene-1,2-diamine;hydrochloride (PubChem CID 19043994) has the molecular formula C6H13ClN2
and a molecular weight of 148.64 g/mol. Its IUPAC name is cyclohex-4-ene-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | cyclohex-4-ene-1,2-diamine;hydrochloride |
| PubChem CID | 19043994 |
| Molecular Formula | C6H13ClN2 |
| Molecular Weight | 148.64 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | cyclohex-4-ene-1,2-diamine;hydrochloride |
| SMILES | Cl.NC1CC=CCC1N |
| InChI | InChI=1S/C6H12N2.ClH/c7-5-3-1-2-4-6(5)8;/h1-2,5-6H,3-4,7-8H2;1H |
| InChIKey | QWKSYVBVTDXWFU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.64 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-4-ene-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-4-ene-1,2-diamine;hydrochloride?
The IUPAC name of cyclohex-4-ene-1,2-diamine;hydrochloride (CID 19043994) is cyclohex-4-ene-1,2-diamine;hydrochloride.
What is the SMILES notation for cyclohex-4-ene-1,2-diamine;hydrochloride?
The canonical SMILES for cyclohex-4-ene-1,2-diamine;hydrochloride is Cl.NC1CC=CCC1N.
What is the InChIKey of cyclohex-4-ene-1,2-diamine;hydrochloride?
The InChIKey is QWKSYVBVTDXWFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.ClH/c7-5-3-1-2-4-6(5)8;/h1-2,5-6H,3-4,7-8H2;1H.
What are the key properties of cyclohex-4-ene-1,2-diamine;hydrochloride?
cyclohex-4-ene-1,2-diamine;hydrochloride has a molecular weight of 148.64 g/mol, XLogP of 0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-4-ene-1,2-diamine;hydrochloride is sourced from PubChem (CID 19043994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).