C21H28N6OS — CID 19044083
N-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-5-[ethyl(hexan-2-yl)amino]phenyl]acetamide (PubChem CID 19044083) has the molecular formula C21H28N6OS and a molecular weight of 412.56 g/mol. Its IUPAC name is N-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-5-[ethyl(hexan-2-yl)amino]phenyl]acetamide.
| Compound Name | N-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-5-[ethyl(hexan-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 19044083 |
| Molecular Formula | C21H28N6OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[2-[(4-cyano-3-methyl-1,2-thiazol-5-yl)diazenyl]-5-[ethyl(hexan-2-yl)amino]phenyl]acetamide |
| SMILES | CCCCC(C)N(CC)c1ccc(/N=N/c2snc(C)c2C#N)c(NC(C)=O)c1 |
| InChI | InChI=1S/C21H28N6OS/c1-6-8-9-14(3)27(7-2)17-10-11-19(20(12-17)23-16(5)28)24-25-21-18(13-22)15(4)26-29-21/h10-12,14H,6-9H2,1-5H3,(H,23,28)/b25-24+ |
| InChIKey | QELJLSYYBRBCDE-OCOZRVBESA-N |
| XLogP | 6.10 |
| TPSA | 93.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|