C19H26N6O2S2 — CID 19044087
N-[5-[ethyl(4-oxopentan-2-yl)amino]-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]acetamide (PubChem CID 19044087) has the molecular formula C19H26N6O2S2 and a molecular weight of 434.59 g/mol. Its IUPAC name is N-[5-[ethyl(4-oxopentan-2-yl)amino]-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]acetamide.
| Compound Name | N-[5-[ethyl(4-oxopentan-2-yl)amino]-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 19044087 |
| Molecular Formula | C19H26N6O2S2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[5-[ethyl(4-oxopentan-2-yl)amino]-2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)diazenyl]phenyl]acetamide |
| SMILES | CCSc1nnc(/N=N/c2ccc(N(CC)C(C)CC(C)=O)cc2NC(C)=O)s1 |
| InChI | InChI=1S/C19H26N6O2S2/c1-6-25(12(3)10-13(4)26)15-8-9-16(17(11-15)20-14(5)27)21-22-18-23-24-19(29-18)28-7-2/h8-9,11-12H,6-7,10H2,1-5H3,(H,20,27)/b22-21+ |
| InChIKey | JTUWLHNKAYCTDQ-QURGRASLSA-N |
| XLogP | 5.22 |
| TPSA | 99.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|