C19H13F3N2O4S — CID 19044541
2-[7-methyl-3-oxo-4-[(5,6,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-1,4-benzoxazin-2-yl]acetic acid (PubChem CID 19044541) has the molecular formula C19H13F3N2O4S and a molecular weight of 422.38 g/mol. Its IUPAC name is 2-[7-methyl-3-oxo-4-[(5,6,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-1,4-benzoxazin-2-yl]acetic acid.
| Compound Name | 2-[7-methyl-3-oxo-4-[(5,6,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-1,4-benzoxazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 19044541 |
| Molecular Formula | C19H13F3N2O4S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 2-[7-methyl-3-oxo-4-[(5,6,7-trifluoro-1,3-benzothiazol-2-yl)methyl]-1,4-benzoxazin-2-yl]acetic acid |
| SMILES | Cc1ccc2c(c1)OC(CC(=O)O)C(=O)N2Cc1nc2cc(F)c(F)c(F)c2s1 |
| InChI | InChI=1S/C19H13F3N2O4S/c1-8-2-3-11-12(4-8)28-13(6-15(25)26)19(27)24(11)7-14-23-10-5-9(20)16(21)17(22)18(10)29-14/h2-5,13H,6-7H2,1H3,(H,25,26) |
| InChIKey | GEKAHCHBRGMHGC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|