About azanylidyneazanium disulfate
azanylidyneazanium disulfate (PubChem CID 19044657) has the molecular formula HN2O8S2-3
and a molecular weight of 221.15 g/mol. Its IUPAC name is azanylidyneazanium disulfate.
Molecular Properties
| Compound Name | azanylidyneazanium disulfate |
| PubChem CID | 19044657 |
| Molecular Formula | HN2O8S2-3 |
| Molecular Weight | 221.15 g/mol |
| Exact Mass | 220.92 |
| IUPAC Name | azanylidyneazanium disulfate |
| SMILES | N#[NH+].O=S(=O)([O-])[O-].O=S(=O)([O-])[O-] |
| InChI | InChI=1S/N2.2H2O4S/c1-2;2*1-5(2,3)4/h;2*(H2,1,2,3,4)/p-3 |
| InChIKey | FLPQLYRCOPAOQI-UHFFFAOYSA-K |
| XLogP | -4.40 |
| TPSA | 208.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.15 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze azanylidyneazanium disulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanylidyneazanium disulfate?
The IUPAC name of azanylidyneazanium disulfate (CID 19044657) is azanylidyneazanium disulfate.
What is the SMILES notation for azanylidyneazanium disulfate?
The canonical SMILES for azanylidyneazanium disulfate is N#[NH+].O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].
What is the InChIKey of azanylidyneazanium disulfate?
The InChIKey is FLPQLYRCOPAOQI-UHFFFAOYSA-K. The full InChI is InChI=1S/N2.2H2O4S/c1-2;2*1-5(2,3)4/h;2*(H2,1,2,3,4)/p-3.
What are the key properties of azanylidyneazanium disulfate?
azanylidyneazanium disulfate has a molecular weight of 221.15 g/mol, XLogP of -4.40, 0 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidyneazanium disulfate is sourced from PubChem (CID 19044657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).