C24H31NO4 — CID 19044848
oxalic acid;8-phenyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 19044848) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is oxalic acid;8-phenyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | oxalic acid;8-phenyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 19044848 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | oxalic acid;8-phenyl-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCN(CCC)C1CCc2cccc(-c3ccccc3)c2C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H29N.C2H2O4/c1-3-15-23(16-4-2)20-14-13-19-11-8-12-21(22(19)17-20)18-9-6-5-7-10-18;3-1(4)2(5)6/h5-12,20H,3-4,13-17H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | OLWDXZMATDLTSS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|