C14H32N4S2 — CID 19044943
1-(3,3,13,13-tetramethyl-1,2-dithia-5,8,11-triazacyclotridec-8-yl)ethanamine (PubChem CID 19044943) has the molecular formula C14H32N4S2 and a molecular weight of 320.57 g/mol. Its IUPAC name is 1-(3,3,13,13-tetramethyl-1,2-dithia-5,8,11-triazacyclotridec-8-yl)ethanamine.
| Compound Name | 1-(3,3,13,13-tetramethyl-1,2-dithia-5,8,11-triazacyclotridec-8-yl)ethanamine |
|---|---|
| PubChem CID | 19044943 |
| Molecular Formula | C14H32N4S2 |
| Molecular Weight | 320.57 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1-(3,3,13,13-tetramethyl-1,2-dithia-5,8,11-triazacyclotridec-8-yl)ethanamine |
| SMILES | CC(N)N1CCNCC(C)(C)SSC(C)(C)CNCC1 |
| InChI | InChI=1S/C14H32N4S2/c1-12(15)18-8-6-16-10-13(2,3)19-20-14(4,5)11-17-7-9-18/h12,16-17H,6-11,15H2,1-5H3 |
| InChIKey | TYIASAWPEFEGPF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|