About bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane
bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane (PubChem CID 19045075) has the molecular formula C22H40O2Si
and a molecular weight of 364.65 g/mol. Its IUPAC name is bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane.
Molecular Properties
| Compound Name | bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane |
| PubChem CID | 19045075 |
| Molecular Formula | C22H40O2Si |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane |
| SMILES | CC(C)=CCC/C(C)=C/CO[Si](C)(C)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H40O2Si/c1-19(2)11-9-13-21(5)15-17-23-25(7,8)24-18-16-22(6)14-10-12-20(3)4/h11-12,15-16H,9-10,13-14,17-18H2,1-8H3/b21-15+,22-16+ |
| InChIKey | HDGRRBNGEXHOLS-YHARCJFQSA-N |
| XLogP | 7.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane?
The IUPAC name of bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane (CID 19045075) is bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane.
What is the SMILES notation for bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane?
The canonical SMILES for bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane is CC(C)=CCC/C(C)=C/CO[Si](C)(C)OC/C=C(\C)CCC=C(C)C.
What is the InChIKey of bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane?
The InChIKey is HDGRRBNGEXHOLS-YHARCJFQSA-N. The full InChI is InChI=1S/C22H40O2Si/c1-19(2)11-9-13-21(5)15-17-23-25(7,8)24-18-16-22(6)14-10-12-20(3)4/h11-12,15-16H,9-10,13-14,17-18H2,1-8H3/b21-15+,22-16+.
What are the key properties of bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane?
bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane has a molecular weight of 364.65 g/mol, XLogP of 7.11, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-dimethylsilane is sourced from PubChem (CID 19045075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).