C25H29N3O3S — CID 19045306
N-[1'-(6-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide (PubChem CID 19045306) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[1'-(6-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide.
| Compound Name | N-[1'-(6-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 19045306 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[1'-(6-cyano-1,2,3,4-tetrahydronaphthalen-2-yl)spiro[3,4-dihydrochromene-2,4'-piperidine]-6-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)CCC1(CCN(C3CCc4cc(C#N)ccc4C3)CC1)O2 |
| InChI | InChI=1S/C25H29N3O3S/c1-32(29,30)27-22-5-7-24-21(15-22)8-9-25(31-24)10-12-28(13-11-25)23-6-4-19-14-18(17-26)2-3-20(19)16-23/h2-3,5,7,14-15,23,27H,4,6,8-13,16H2,1H3 |
| InChIKey | NJYXPVGGIJADON-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |