About 5-(2-bromoethoxy)-2,1,3-benzoxadiazole
5-(2-bromoethoxy)-2,1,3-benzoxadiazole (PubChem CID 19045351) has the molecular formula C8H7BrN2O2
and a molecular weight of 243.06 g/mol. Its IUPAC name is 5-(2-bromoethoxy)-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 5-(2-bromoethoxy)-2,1,3-benzoxadiazole |
| PubChem CID | 19045351 |
| Molecular Formula | C8H7BrN2O2 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 5-(2-bromoethoxy)-2,1,3-benzoxadiazole |
| SMILES | BrCCOc1ccc2nonc2c1 |
| InChI | InChI=1S/C8H7BrN2O2/c9-3-4-12-6-1-2-7-8(5-6)11-13-10-7/h1-2,5H,3-4H2 |
| InChIKey | MYHTZSROCPENTF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-bromoethoxy)-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromoethoxy)-2,1,3-benzoxadiazole?
The IUPAC name of 5-(2-bromoethoxy)-2,1,3-benzoxadiazole (CID 19045351) is 5-(2-bromoethoxy)-2,1,3-benzoxadiazole.
What is the SMILES notation for 5-(2-bromoethoxy)-2,1,3-benzoxadiazole?
The canonical SMILES for 5-(2-bromoethoxy)-2,1,3-benzoxadiazole is BrCCOc1ccc2nonc2c1.
What is the InChIKey of 5-(2-bromoethoxy)-2,1,3-benzoxadiazole?
The InChIKey is MYHTZSROCPENTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2O2/c9-3-4-12-6-1-2-7-8(5-6)11-13-10-7/h1-2,5H,3-4H2.
What are the key properties of 5-(2-bromoethoxy)-2,1,3-benzoxadiazole?
5-(2-bromoethoxy)-2,1,3-benzoxadiazole has a molecular weight of 243.06 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromoethoxy)-2,1,3-benzoxadiazole is sourced from PubChem (CID 19045351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).