About spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine]
spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine] (PubChem CID 19045721) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine].
Molecular Properties
| Compound Name | spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine] |
| PubChem CID | 19045721 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine] |
| SMILES | c1ccc2c(c1)CCC1(COCCN1)C2 |
| InChI | InChI=1S/C13H17NO/c1-2-4-12-9-13(6-5-11(12)3-1)10-15-8-7-14-13/h1-4,14H,5-10H2 |
| InChIKey | RLFUHJJGYYPDAF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine]?
The IUPAC name of spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine] (CID 19045721) is spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine].
What is the SMILES notation for spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine]?
The canonical SMILES for spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine] is c1ccc2c(c1)CCC1(COCCN1)C2.
What is the InChIKey of spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine]?
The InChIKey is RLFUHJJGYYPDAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-2-4-12-9-13(6-5-11(12)3-1)10-15-8-7-14-13/h1-4,14H,5-10H2.
What are the key properties of spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine]?
spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine] has a molecular weight of 203.28 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2,4-dihydro-1H-naphthalene-3,3'-morpholine] is sourced from PubChem (CID 19045721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).