C13H19N — CID 19045822
1,2,3,4,4a,8,9,10,10a,10b-decahydrobenzo[f]quinoline (PubChem CID 19045822) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 1,2,3,4,4a,8,9,10,10a,10b-decahydrobenzo[f]quinoline.
| Compound Name | 1,2,3,4,4a,8,9,10,10a,10b-decahydrobenzo[f]quinoline |
|---|---|
| PubChem CID | 19045822 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1,2,3,4,4a,8,9,10,10a,10b-decahydrobenzo[f]quinoline |
| SMILES | C1=CC2NCCCC2C2CCCC=C12 |
| InChI | InChI=1S/C13H19N/c1-2-5-11-10(4-1)7-8-13-12(11)6-3-9-14-13/h4,7-8,11-14H,1-3,5-6,9H2 |
| InChIKey | XDLZTMYMSJEYHV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |