About butane-1,1-diol;propane-1,1-diol
butane-1,1-diol;propane-1,1-diol (PubChem CID 19046618) has the molecular formula C7H18O4
and a molecular weight of 166.22 g/mol. Its IUPAC name is butane-1,1-diol;propane-1,1-diol.
Molecular Properties
| Compound Name | butane-1,1-diol;propane-1,1-diol |
| PubChem CID | 19046618 |
| Molecular Formula | C7H18O4 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | butane-1,1-diol;propane-1,1-diol |
| SMILES | CCC(O)O.CCCC(O)O |
| InChI | InChI=1S/C4H10O2.C3H8O2/c1-2-3-4(5)6;1-2-3(4)5/h4-6H,2-3H2,1H3;3-5H,2H2,1H3 |
| InChIKey | XXPWFPYMVQVIAJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butane-1,1-diol;propane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,1-diol;propane-1,1-diol?
The IUPAC name of butane-1,1-diol;propane-1,1-diol (CID 19046618) is butane-1,1-diol;propane-1,1-diol.
What is the SMILES notation for butane-1,1-diol;propane-1,1-diol?
The canonical SMILES for butane-1,1-diol;propane-1,1-diol is CCC(O)O.CCCC(O)O.
What is the InChIKey of butane-1,1-diol;propane-1,1-diol?
The InChIKey is XXPWFPYMVQVIAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C3H8O2/c1-2-3-4(5)6;1-2-3(4)5/h4-6H,2-3H2,1H3;3-5H,2H2,1H3.
What are the key properties of butane-1,1-diol;propane-1,1-diol?
butane-1,1-diol;propane-1,1-diol has a molecular weight of 166.22 g/mol, XLogP of -0.20, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,1-diol;propane-1,1-diol is sourced from PubChem (CID 19046618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).