About 5-oxo-1,2-dihydropyrazole-3-carboxamide
5-oxo-1,2-dihydropyrazole-3-carboxamide (PubChem CID 19046836) has the molecular formula C4H5N3O2
and a molecular weight of 127.10 g/mol. Its IUPAC name is 5-oxo-1,2-dihydropyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-oxo-1,2-dihydropyrazole-3-carboxamide |
| PubChem CID | 19046836 |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 5-oxo-1,2-dihydropyrazole-3-carboxamide |
| SMILES | NC(=O)c1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C4H5N3O2/c5-4(9)2-1-3(8)7-6-2/h1H,(H2,5,9)(H2,6,7,8) |
| InChIKey | LPWPMUASMQVHBZ-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-oxo-1,2-dihydropyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-1,2-dihydropyrazole-3-carboxamide?
The IUPAC name of 5-oxo-1,2-dihydropyrazole-3-carboxamide (CID 19046836) is 5-oxo-1,2-dihydropyrazole-3-carboxamide.
What is the SMILES notation for 5-oxo-1,2-dihydropyrazole-3-carboxamide?
The canonical SMILES for 5-oxo-1,2-dihydropyrazole-3-carboxamide is NC(=O)c1cc(=O)[nH][nH]1.
What is the InChIKey of 5-oxo-1,2-dihydropyrazole-3-carboxamide?
The InChIKey is LPWPMUASMQVHBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2/c5-4(9)2-1-3(8)7-6-2/h1H,(H2,5,9)(H2,6,7,8).
What are the key properties of 5-oxo-1,2-dihydropyrazole-3-carboxamide?
5-oxo-1,2-dihydropyrazole-3-carboxamide has a molecular weight of 127.10 g/mol, XLogP of -1.20, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1,2-dihydropyrazole-3-carboxamide is sourced from PubChem (CID 19046836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).