About 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine
2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine (PubChem CID 19046971) has the molecular formula C31H46FNO3
and a molecular weight of 499.71 g/mol. Its IUPAC name is 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine.
Molecular Properties
| Compound Name | 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine |
| PubChem CID | 19046971 |
| Molecular Formula | C31H46FNO3 |
| Molecular Weight | 499.71 g/mol |
| Exact Mass | 499.35 |
| IUPAC Name | 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C3OCC(CCCCCCCC)CO3)c(F)n2)cc1 |
| InChI | InChI=1S/C31H46FNO3/c1-3-5-7-9-11-13-15-25-23-35-31(36-24-25)28-20-21-29(33-30(28)32)26-16-18-27(19-17-26)34-22-14-12-10-8-6-4-2/h16-21,25,31H,3-15,22-24H2,1-2H3 |
| InChIKey | YRRIMFZMIHJVFZ-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.71 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine?
The IUPAC name of 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine (CID 19046971) is 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine.
What is the SMILES notation for 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine?
The canonical SMILES for 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine is CCCCCCCCOc1ccc(-c2ccc(C3OCC(CCCCCCCC)CO3)c(F)n2)cc1.
What is the InChIKey of 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine?
The InChIKey is YRRIMFZMIHJVFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H46FNO3/c1-3-5-7-9-11-13-15-25-23-35-31(36-24-25)28-20-21-29(33-30(28)32)26-16-18-27(19-17-26)34-22-14-12-10-8-6-4-2/h16-21,25,31H,3-15,22-24H2,1-2H3.
What are the key properties of 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine?
2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine has a molecular weight of 499.71 g/mol, XLogP of 9.04, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-(4-octoxyphenyl)-3-(5-octyl-1,3-dioxan-2-yl)pyridine is sourced from PubChem (CID 19046971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).