About 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one
1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one (PubChem CID 19047332) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one |
| PubChem CID | 19047332 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one |
| SMILES | O=c1ccccn1C1CC(O)C(O)C1O |
| InChI | InChI=1S/C10H13NO4/c12-7-5-6(9(14)10(7)15)11-4-2-1-3-8(11)13/h1-4,6-7,9-10,12,14-15H,5H2 |
| InChIKey | AIKZMEVOSFFNOX-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one?
The IUPAC name of 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one (CID 19047332) is 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one.
What is the SMILES notation for 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one?
The canonical SMILES for 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one is O=c1ccccn1C1CC(O)C(O)C1O.
What is the InChIKey of 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one?
The InChIKey is AIKZMEVOSFFNOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4/c12-7-5-6(9(14)10(7)15)11-4-2-1-3-8(11)13/h1-4,6-7,9-10,12,14-15H,5H2.
What are the key properties of 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one?
1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one has a molecular weight of 211.22 g/mol, XLogP of -1.12, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3,4-trihydroxycyclopentyl)pyridin-2-one is sourced from PubChem (CID 19047332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).