C17H14NO2+ — CID 19047570
11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol (PubChem CID 19047570) has the molecular formula C17H14NO2+ and a molecular weight of 264.30 g/mol. Its IUPAC name is 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol.
| Compound Name | 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol |
|---|---|
| PubChem CID | 19047570 |
| Molecular Formula | C17H14NO2+ |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol |
| SMILES | Oc1cccc2c1C(c1ccoc1)c1cccc[n+]1C2 |
| InChI | InChI=1S/C17H13NO2/c19-15-6-3-4-12-10-18-8-2-1-5-14(18)16(17(12)15)13-7-9-20-11-13/h1-9,11,16H,10H2/p+1 |
| InChIKey | IIRDGCFLOMSABI-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 37.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|