About 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol
11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol (PubChem CID 19047570) has the molecular formula C17H14NO2+
and a molecular weight of 264.30 g/mol. Its IUPAC name is 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol.
Molecular Properties
| Compound Name | 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol |
| PubChem CID | 19047570 |
| Molecular Formula | C17H14NO2+ |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol |
| SMILES | Oc1cccc2c1C(c1ccoc1)c1cccc[n+]1C2 |
| InChI | InChI=1S/C17H13NO2/c19-15-6-3-4-12-10-18-8-2-1-5-14(18)16(17(12)15)13-7-9-20-11-13/h1-9,11,16H,10H2/p+1 |
| InChIKey | IIRDGCFLOMSABI-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 37.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol?
The IUPAC name of 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol (CID 19047570) is 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol.
What is the SMILES notation for 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol?
The canonical SMILES for 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol is Oc1cccc2c1C(c1ccoc1)c1cccc[n+]1C2.
What is the InChIKey of 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol?
The InChIKey is IIRDGCFLOMSABI-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H13NO2/c19-15-6-3-4-12-10-18-8-2-1-5-14(18)16(17(12)15)13-7-9-20-11-13/h1-9,11,16H,10H2/p+1.
What are the key properties of 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol?
11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol has a molecular weight of 264.30 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(furan-3-yl)-6,11-dihydrobenzo[b]quinolizin-5-ium-10-ol is sourced from PubChem (CID 19047570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).