About 3-(1-ethoxyethenyl)furan
3-(1-ethoxyethenyl)furan (PubChem CID 19047584) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 3-(1-ethoxyethenyl)furan.
Molecular Properties
| Compound Name | 3-(1-ethoxyethenyl)furan |
| PubChem CID | 19047584 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 3-(1-ethoxyethenyl)furan |
| SMILES | C=C(OCC)c1ccoc1 |
| InChI | InChI=1S/C8H10O2/c1-3-10-7(2)8-4-5-9-6-8/h4-6H,2-3H2,1H3 |
| InChIKey | IHWGUQSPJADRDV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-ethoxyethenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethoxyethenyl)furan?
The IUPAC name of 3-(1-ethoxyethenyl)furan (CID 19047584) is 3-(1-ethoxyethenyl)furan.
What is the SMILES notation for 3-(1-ethoxyethenyl)furan?
The canonical SMILES for 3-(1-ethoxyethenyl)furan is C=C(OCC)c1ccoc1.
What is the InChIKey of 3-(1-ethoxyethenyl)furan?
The InChIKey is IHWGUQSPJADRDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-3-10-7(2)8-4-5-9-6-8/h4-6H,2-3H2,1H3.
What are the key properties of 3-(1-ethoxyethenyl)furan?
3-(1-ethoxyethenyl)furan has a molecular weight of 138.17 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethoxyethenyl)furan is sourced from PubChem (CID 19047584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).