C8H14N2 — CID 19047600
2-methyl-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine (PubChem CID 19047600) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-methyl-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine.
| Compound Name | 2-methyl-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 19047600 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-methyl-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridine |
| SMILES | CC1CC=C2CNCC2N1 |
| InChI | InChI=1S/C8H14N2/c1-6-2-3-7-4-9-5-8(7)10-6/h3,6,8-10H,2,4-5H2,1H3 |
| InChIKey | NSWYKPBOPCHODO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|