C10F20 — CID 19047903
1,1,1,3,5,5,6,6,6-nonafluoro-4-(1,1,2,2,2-pentafluoroethyl)-2,4-bis(trifluoromethyl)hex-2-ene (PubChem CID 19047903) has the molecular formula C10F20 and a molecular weight of 500.07 g/mol. Its IUPAC name is 1,1,1,3,5,5,6,6,6-nonafluoro-4-(1,1,2,2,2-pentafluoroethyl)-2,4-bis(trifluoromethyl)hex-2-ene.
| Compound Name | 1,1,1,3,5,5,6,6,6-nonafluoro-4-(1,1,2,2,2-pentafluoroethyl)-2,4-bis(trifluoromethyl)hex-2-ene |
|---|---|
| PubChem CID | 19047903 |
| Molecular Formula | C10F20 |
| Molecular Weight | 500.07 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | 1,1,1,3,5,5,6,6,6-nonafluoro-4-(1,1,2,2,2-pentafluoroethyl)-2,4-bis(trifluoromethyl)hex-2-ene |
| SMILES | FC(=C(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10F20/c11-2(1(4(12,13)14)5(15,16)17)3(8(22,23)24,6(18,19)9(25,26)27)7(20,21)10(28,29)30 |
| InChIKey | BJNIHPPNYUWLPW-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.07 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|