About ethenoxyethene;3-methylpentane-1,5-diol
ethenoxyethene;3-methylpentane-1,5-diol (PubChem CID 19047938) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is ethenoxyethene;3-methylpentane-1,5-diol.
Molecular Properties
| Compound Name | ethenoxyethene;3-methylpentane-1,5-diol |
| PubChem CID | 19047938 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | ethenoxyethene;3-methylpentane-1,5-diol |
| SMILES | C=COC=C.CC(CCO)CCO |
| InChI | InChI=1S/C6H14O2.C4H6O/c1-6(2-4-7)3-5-8;1-3-5-4-2/h6-8H,2-5H2,1H3;3-4H,1-2H2 |
| InChIKey | SWPKTOQPUBLCRA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenoxyethene;3-methylpentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxyethene;3-methylpentane-1,5-diol?
The IUPAC name of ethenoxyethene;3-methylpentane-1,5-diol (CID 19047938) is ethenoxyethene;3-methylpentane-1,5-diol.
What is the SMILES notation for ethenoxyethene;3-methylpentane-1,5-diol?
The canonical SMILES for ethenoxyethene;3-methylpentane-1,5-diol is C=COC=C.CC(CCO)CCO.
What is the InChIKey of ethenoxyethene;3-methylpentane-1,5-diol?
The InChIKey is SWPKTOQPUBLCRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C4H6O/c1-6(2-4-7)3-5-8;1-3-5-4-2/h6-8H,2-5H2,1H3;3-4H,1-2H2.
What are the key properties of ethenoxyethene;3-methylpentane-1,5-diol?
ethenoxyethene;3-methylpentane-1,5-diol has a molecular weight of 188.27 g/mol, XLogP of 1.68, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxyethene;3-methylpentane-1,5-diol is sourced from PubChem (CID 19047938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).