C16H15NO2 — CID 19048225
N-propyldibenzofuran-2-carboxamide (PubChem CID 19048225) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-propyldibenzofuran-2-carboxamide.
| Compound Name | N-propyldibenzofuran-2-carboxamide |
|---|---|
| PubChem CID | 19048225 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-propyldibenzofuran-2-carboxamide |
| SMILES | CCCNC(=O)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C16H15NO2/c1-2-9-17-16(18)11-7-8-15-13(10-11)12-5-3-4-6-14(12)19-15/h3-8,10H,2,9H2,1H3,(H,17,18) |
| InChIKey | SPKZXVQETKBELY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |