About 2-chloro-1-N-methylbenzene-1,4-diamine
2-chloro-1-N-methylbenzene-1,4-diamine (PubChem CID 19048352) has the molecular formula C7H9ClN2
and a molecular weight of 156.62 g/mol. Its IUPAC name is 2-chloro-1-N-methylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-chloro-1-N-methylbenzene-1,4-diamine |
| PubChem CID | 19048352 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2-chloro-1-N-methylbenzene-1,4-diamine |
| SMILES | CNc1ccc(N)cc1Cl |
| InChI | InChI=1S/C7H9ClN2/c1-10-7-3-2-5(9)4-6(7)8/h2-4,10H,9H2,1H3 |
| InChIKey | XCGOCWBIFFICFZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-N-methylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-N-methylbenzene-1,4-diamine?
The IUPAC name of 2-chloro-1-N-methylbenzene-1,4-diamine (CID 19048352) is 2-chloro-1-N-methylbenzene-1,4-diamine.
What is the SMILES notation for 2-chloro-1-N-methylbenzene-1,4-diamine?
The canonical SMILES for 2-chloro-1-N-methylbenzene-1,4-diamine is CNc1ccc(N)cc1Cl.
What is the InChIKey of 2-chloro-1-N-methylbenzene-1,4-diamine?
The InChIKey is XCGOCWBIFFICFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2/c1-10-7-3-2-5(9)4-6(7)8/h2-4,10H,9H2,1H3.
What are the key properties of 2-chloro-1-N-methylbenzene-1,4-diamine?
2-chloro-1-N-methylbenzene-1,4-diamine has a molecular weight of 156.62 g/mol, XLogP of 1.96, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-N-methylbenzene-1,4-diamine is sourced from PubChem (CID 19048352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).