About N,N-diethylpropan-1-amine;methanol;titanium
N,N-diethylpropan-1-amine;methanol;titanium (PubChem CID 19048455) has the molecular formula C10H28NO3Ti-
and a molecular weight of 258.20 g/mol. Its IUPAC name is N,N-diethylpropan-1-amine;methanol;titanium.
Molecular Properties
| Compound Name | N,N-diethylpropan-1-amine;methanol;titanium |
| PubChem CID | 19048455 |
| Molecular Formula | C10H28NO3Ti- |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | N,N-diethylpropan-1-amine;methanol;titanium |
| SMILES | CO.CO.CO.[CH2-]CCN(CC)CC.[Ti] |
| InChI | InChI=1S/C7H16N.3CH4O.Ti/c1-4-7-8(5-2)6-3;3*1-2;/h1,4-7H2,2-3H3;3*2H,1H3;/q-1;;;; |
| InChIKey | YGWDAWZWPOJGMJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylpropan-1-amine;methanol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylpropan-1-amine;methanol;titanium?
The IUPAC name of N,N-diethylpropan-1-amine;methanol;titanium (CID 19048455) is N,N-diethylpropan-1-amine;methanol;titanium.
What is the SMILES notation for N,N-diethylpropan-1-amine;methanol;titanium?
The canonical SMILES for N,N-diethylpropan-1-amine;methanol;titanium is CO.CO.CO.[CH2-]CCN(CC)CC.[Ti].
What is the InChIKey of N,N-diethylpropan-1-amine;methanol;titanium?
The InChIKey is YGWDAWZWPOJGMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N.3CH4O.Ti/c1-4-7-8(5-2)6-3;3*1-2;/h1,4-7H2,2-3H3;3*2H,1H3;/q-1;;;;.
What are the key properties of N,N-diethylpropan-1-amine;methanol;titanium?
N,N-diethylpropan-1-amine;methanol;titanium has a molecular weight of 258.20 g/mol, XLogP of 0.38, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylpropan-1-amine;methanol;titanium is sourced from PubChem (CID 19048455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).