C13H13Cl2N3O3 — CID 19048544
methyl 2-(2,6-dichloro-4-pyridinyl)-4-ethyl-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 19048544) has the molecular formula C13H13Cl2N3O3 and a molecular weight of 330.17 g/mol. Its IUPAC name is methyl 2-(2,6-dichloro-4-pyridinyl)-4-ethyl-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 2-(2,6-dichloro-4-pyridinyl)-4-ethyl-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 19048544 |
| Molecular Formula | C13H13Cl2N3O3 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | methyl 2-(2,6-dichloro-4-pyridinyl)-4-ethyl-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCC1N=C(c2cc(Cl)nc(Cl)c2)NC(=O)C1C(=O)OC |
| InChI | InChI=1S/C13H13Cl2N3O3/c1-3-7-10(13(20)21-2)12(19)18-11(16-7)6-4-8(14)17-9(15)5-6/h4-5,7,10H,3H2,1-2H3,(H,16,18,19) |
| InChIKey | AKHDQGVVWAJPBM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|