About 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine
2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine (PubChem CID 19048649) has the molecular formula C13H23N5O2
and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine.
Molecular Properties
| Compound Name | 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine |
| PubChem CID | 19048649 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine |
| SMILES | COC1=NC(C(C)C)C(OC)=NC1CCCCN=[N+]=[N-] |
| InChI | InChI=1S/C13H23N5O2/c1-9(2)11-13(20-4)16-10(12(17-11)19-3)7-5-6-8-15-18-14/h9-11H,5-8H2,1-4H3 |
| InChIKey | YFUMLHQPZMNIDA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 91.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine?
The IUPAC name of 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine (CID 19048649) is 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine.
What is the SMILES notation for 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine?
The canonical SMILES for 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine is COC1=NC(C(C)C)C(OC)=NC1CCCCN=[N+]=[N-].
What is the InChIKey of 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine?
The InChIKey is YFUMLHQPZMNIDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N5O2/c1-9(2)11-13(20-4)16-10(12(17-11)19-3)7-5-6-8-15-18-14/h9-11H,5-8H2,1-4H3.
What are the key properties of 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine?
2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine has a molecular weight of 281.36 g/mol, XLogP of 2.96, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-azidobutyl)-3,6-dimethoxy-5-propan-2-yl-2,5-dihydropyrazine is sourced from PubChem (CID 19048649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).