C20H24N4O2 — CID 19048850
2-[7-[[4-(diaminomethylideneamino)phenyl]methylamino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid (PubChem CID 19048850) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[7-[[4-(diaminomethylideneamino)phenyl]methylamino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid.
| Compound Name | 2-[7-[[4-(diaminomethylideneamino)phenyl]methylamino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 19048850 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[7-[[4-(diaminomethylideneamino)phenyl]methylamino]-1,2,3,4-tetrahydronaphthalen-2-yl]acetic acid |
| SMILES | NC(N)=Nc1ccc(CNc2ccc3c(c2)CC(CC(=O)O)CC3)cc1 |
| InChI | InChI=1S/C20H24N4O2/c21-20(22)24-17-6-2-13(3-7-17)12-23-18-8-5-15-4-1-14(10-19(25)26)9-16(15)11-18/h2-3,5-8,11,14,23H,1,4,9-10,12H2,(H,25,26)(H4,21,22,24) |
| InChIKey | RJKYNGUZYGYPLZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|