About tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride
tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride (PubChem CID 19049020) has the molecular formula C9H18ClN3O2
and a molecular weight of 235.71 g/mol. Its IUPAC name is tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride |
| PubChem CID | 19049020 |
| Molecular Formula | C9H18ClN3O2 |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCN=C(N)C1.Cl |
| InChI | InChI=1S/C9H17N3O2.ClH/c1-9(2,3)14-8(13)12-5-4-11-7(10)6-12;/h4-6H2,1-3H3,(H2,10,11);1H |
| InChIKey | MRXNSIJMEQUGON-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride?
The IUPAC name of tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride (CID 19049020) is tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride.
What is the SMILES notation for tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride?
The canonical SMILES for tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride is CC(C)(C)OC(=O)N1CCN=C(N)C1.Cl.
What is the InChIKey of tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride?
The InChIKey is MRXNSIJMEQUGON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2.ClH/c1-9(2,3)14-8(13)12-5-4-11-7(10)6-12;/h4-6H2,1-3H3,(H2,10,11);1H.
What are the key properties of tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride?
tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride has a molecular weight of 235.71 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-amino-3,5-dihydro-2H-pyrazine-4-carboxylate;hydrochloride is sourced from PubChem (CID 19049020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).