About 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride
3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride (PubChem CID 19049128) has the molecular formula C6H13ClN2
and a molecular weight of 148.64 g/mol. Its IUPAC name is 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride |
| PubChem CID | 19049128 |
| Molecular Formula | C6H13ClN2 |
| Molecular Weight | 148.64 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride |
| SMILES | CCC1CN=C(N)C1.Cl |
| InChI | InChI=1S/C6H12N2.ClH/c1-2-5-3-6(7)8-4-5;/h5H,2-4H2,1H3,(H2,7,8);1H |
| InChIKey | FPPOUWBAWOILPS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.64 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The IUPAC name of 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride (CID 19049128) is 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride.
What is the SMILES notation for 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The canonical SMILES for 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride is CCC1CN=C(N)C1.Cl.
What is the InChIKey of 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
The InChIKey is FPPOUWBAWOILPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.ClH/c1-2-5-3-6(7)8-4-5;/h5H,2-4H2,1H3,(H2,7,8);1H.
What are the key properties of 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride?
3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride has a molecular weight of 148.64 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3,4-dihydro-2H-pyrrol-5-amine;hydrochloride is sourced from PubChem (CID 19049128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).