About 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine
2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 19049152) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine.
Molecular Properties
| Compound Name | 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine |
| PubChem CID | 19049152 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CCCC1CC(N)=NC1C |
| InChI | InChI=1S/C8H16N2/c1-3-4-7-5-8(9)10-6(7)2/h6-7H,3-5H2,1-2H3,(H2,9,10) |
| InChIKey | KBOKLILFNBAIHC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine?
The IUPAC name of 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine (CID 19049152) is 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine.
What is the SMILES notation for 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine?
The canonical SMILES for 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine is CCCC1CC(N)=NC1C.
What is the InChIKey of 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine?
The InChIKey is KBOKLILFNBAIHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-3-4-7-5-8(9)10-6(7)2/h6-7H,3-5H2,1-2H3,(H2,9,10).
What are the key properties of 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine?
2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine has a molecular weight of 140.23 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine is sourced from PubChem (CID 19049152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).