C29H30F6N2O3 — CID 19049343
2-[[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylpropan-2-yl]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 19049343) has the molecular formula C29H30F6N2O3 and a molecular weight of 568.56 g/mol. Its IUPAC name is 2-[[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylpropan-2-yl]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylpropan-2-yl]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 19049343 |
| Molecular Formula | C29H30F6N2O3 |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | 2-[[3-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1,1-diphenylpropan-2-yl]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNC(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H30F6N2O3/c1-39-13-12-36-26(38)17-37-25(27(21-8-4-2-5-9-21)22-10-6-3-7-11-22)19-40-18-20-14-23(28(30,31)32)16-24(15-20)29(33,34)35/h2-11,14-16,25,27,37H,12-13,17-19H2,1H3,(H,36,38) |
| InChIKey | QYVSSSDIPNYJLX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|