About 2,3-diisothiocyanato-2,3-dimethylbutane
2,3-diisothiocyanato-2,3-dimethylbutane (PubChem CID 19049743) has the molecular formula C8H12N2S2
and a molecular weight of 200.33 g/mol. Its IUPAC name is 2,3-diisothiocyanato-2,3-dimethylbutane.
Molecular Properties
| Compound Name | 2,3-diisothiocyanato-2,3-dimethylbutane |
| PubChem CID | 19049743 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 2,3-diisothiocyanato-2,3-dimethylbutane |
| SMILES | CC(C)(N=C=S)C(C)(C)N=C=S |
| InChI | InChI=1S/C8H12N2S2/c1-7(2,9-5-11)8(3,4)10-6-12/h1-4H3 |
| InChIKey | ATSIWBTUDOEDEM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diisothiocyanato-2,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diisothiocyanato-2,3-dimethylbutane?
The IUPAC name of 2,3-diisothiocyanato-2,3-dimethylbutane (CID 19049743) is 2,3-diisothiocyanato-2,3-dimethylbutane.
What is the SMILES notation for 2,3-diisothiocyanato-2,3-dimethylbutane?
The canonical SMILES for 2,3-diisothiocyanato-2,3-dimethylbutane is CC(C)(N=C=S)C(C)(C)N=C=S.
What is the InChIKey of 2,3-diisothiocyanato-2,3-dimethylbutane?
The InChIKey is ATSIWBTUDOEDEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S2/c1-7(2,9-5-11)8(3,4)10-6-12/h1-4H3.
What are the key properties of 2,3-diisothiocyanato-2,3-dimethylbutane?
2,3-diisothiocyanato-2,3-dimethylbutane has a molecular weight of 200.33 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diisothiocyanato-2,3-dimethylbutane is sourced from PubChem (CID 19049743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).