About (Z)-1-chloro-2,3,3-trifluoroprop-1-ene
(Z)-1-chloro-2,3,3-trifluoroprop-1-ene (PubChem CID 19050221) has the molecular formula C3H2ClF3
and a molecular weight of 130.50 g/mol. Its IUPAC name is (Z)-1-chloro-2,3,3-trifluoroprop-1-ene.
Molecular Properties
| Compound Name | (Z)-1-chloro-2,3,3-trifluoroprop-1-ene |
| PubChem CID | 19050221 |
| Molecular Formula | C3H2ClF3 |
| Molecular Weight | 130.50 g/mol |
| Exact Mass | 129.98 |
| IUPAC Name | (Z)-1-chloro-2,3,3-trifluoroprop-1-ene |
| SMILES | F/C(=C\Cl)C(F)F |
| InChI | InChI=1S/C3H2ClF3/c4-1-2(5)3(6)7/h1,3H/b2-1- |
| InChIKey | USCSECLOSDIOTA-UPHRSURJSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (Z)-1-chloro-2,3,3-trifluoroprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-chloro-2,3,3-trifluoroprop-1-ene?
The IUPAC name of (Z)-1-chloro-2,3,3-trifluoroprop-1-ene (CID 19050221) is (Z)-1-chloro-2,3,3-trifluoroprop-1-ene.
What is the SMILES notation for (Z)-1-chloro-2,3,3-trifluoroprop-1-ene?
The canonical SMILES for (Z)-1-chloro-2,3,3-trifluoroprop-1-ene is F/C(=C\Cl)C(F)F.
What is the InChIKey of (Z)-1-chloro-2,3,3-trifluoroprop-1-ene?
The InChIKey is USCSECLOSDIOTA-UPHRSURJSA-N. The full InChI is InChI=1S/C3H2ClF3/c4-1-2(5)3(6)7/h1,3H/b2-1-.
What are the key properties of (Z)-1-chloro-2,3,3-trifluoroprop-1-ene?
(Z)-1-chloro-2,3,3-trifluoroprop-1-ene has a molecular weight of 130.50 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-chloro-2,3,3-trifluoroprop-1-ene is sourced from PubChem (CID 19050221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).