C31H32F13NO3 — CID 19050274
5-[2-(9-cyclopropylnonyl)-1,3-benzodioxol-5-yl]-2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)pyridine (PubChem CID 19050274) has the molecular formula C31H32F13NO3 and a molecular weight of 713.58 g/mol. Its IUPAC name is 5-[2-(9-cyclopropylnonyl)-1,3-benzodioxol-5-yl]-2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)pyridine.
| Compound Name | 5-[2-(9-cyclopropylnonyl)-1,3-benzodioxol-5-yl]-2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)pyridine |
|---|---|
| PubChem CID | 19050274 |
| Molecular Formula | C31H32F13NO3 |
| Molecular Weight | 713.58 g/mol |
| Exact Mass | 713.22 |
| IUPAC Name | 5-[2-(9-cyclopropylnonyl)-1,3-benzodioxol-5-yl]-2-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxy)pyridine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COc1ccc(-c2ccc3c(c2)OC(CCCCCCCCCC2CC2)O3)cn1 |
| InChI | InChI=1S/C31H32F13NO3/c32-26(33,27(34,35)28(36,37)29(38,39)30(40,41)31(42,43)44)18-46-24-15-13-21(17-45-24)20-12-14-22-23(16-20)48-25(47-22)9-7-5-3-1-2-4-6-8-19-10-11-19/h12-17,19,25H,1-11,18H2 |
| InChIKey | SRXBIYRELQZDNT-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.58 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|