About N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine
N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine (PubChem CID 19050558) has the molecular formula C11H29N3
and a molecular weight of 203.37 g/mol. Its IUPAC name is N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine.
Molecular Properties
| Compound Name | N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine |
| PubChem CID | 19050558 |
| Molecular Formula | C11H29N3 |
| Molecular Weight | 203.37 g/mol |
| Exact Mass | 203.24 |
| IUPAC Name | N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine |
| SMILES | CC(C)CC(C)N.CN(C)CCCN |
| InChI | InChI=1S/C6H15N.C5H14N2/c1-5(2)4-6(3)7;1-7(2)5-3-4-6/h5-6H,4,7H2,1-3H3;3-6H2,1-2H3 |
| InChIKey | MRHWBOZJJGCIHC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine?
The IUPAC name of N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine (CID 19050558) is N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine.
What is the SMILES notation for N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine?
The canonical SMILES for N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine is CC(C)CC(C)N.CN(C)CCCN.
What is the InChIKey of N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine?
The InChIKey is MRHWBOZJJGCIHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C5H14N2/c1-5(2)4-6(3)7;1-7(2)5-3-4-6/h5-6H,4,7H2,1-3H3;3-6H2,1-2H3.
What are the key properties of N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine?
N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine has a molecular weight of 203.37 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dimethylpropane-1,3-diamine;4-methylpentan-2-amine is sourced from PubChem (CID 19050558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).