C37H36N4O7S2 — CID 19052946
ethyl 2-[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19052946) has the molecular formula C37H36N4O7S2 and a molecular weight of 712.85 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19052946 |
| Molecular Formula | C37H36N4O7S2 |
| Molecular Weight | 712.85 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)c2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C37H36N4O7S2/c1-4-48-37(45)32-29-18-13-22(2)19-31(29)50-36(32)40-33(42)23(3)49-28-12-8-11-26(21-28)38-35(44)30(39-34(43)25-9-6-5-7-10-25)20-24-14-16-27(17-15-24)41(46)47/h5-12,14-17,20-23H,4,13,18-19H2,1-3H3,(H,38,44)(H,39,43)(H,40,42)/b30-20+ |
| InChIKey | GFRRWQIHJWFRPS-TWKHWXDSSA-N |
| XLogP | 7.49 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.85 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|