C30H34ClN5O2S — CID 19056087
2-[6-(2-chlorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]acetamide (PubChem CID 19056087) has the molecular formula C30H34ClN5O2S and a molecular weight of 564.16 g/mol. Its IUPAC name is 2-[6-(2-chlorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[6-(2-chlorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 19056087 |
| Molecular Formula | C30H34ClN5O2S |
| Molecular Weight | 564.16 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 2-[6-(2-chlorophenyl)-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]-N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]acetamide |
| SMILES | Cc1[nH]cnc1CSCCNC(=O)CN1c2ccccc2NC2=C(C(=O)CC(C)(C)C2)C1c1ccccc1Cl |
| InChI | InChI=1S/C30H34ClN5O2S/c1-19-24(34-18-33-19)17-39-13-12-32-27(38)16-36-25-11-7-6-10-22(25)35-23-14-30(2,3)15-26(37)28(23)29(36)20-8-4-5-9-21(20)31/h4-11,18,29,35H,12-17H2,1-3H3,(H,32,38)(H,33,34) |
| InChIKey | AWBQGHNEHSDYAY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.16 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|