C32H35ClN4O2 — CID 19056934
N-[(4-chlorophenyl)methyl]-2-[6-[4-(dimethylamino)phenyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide (PubChem CID 19056934) has the molecular formula C32H35ClN4O2 and a molecular weight of 543.11 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[6-[4-(dimethylamino)phenyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[6-[4-(dimethylamino)phenyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide |
|---|---|
| PubChem CID | 19056934 |
| Molecular Formula | C32H35ClN4O2 |
| Molecular Weight | 543.11 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[6-[4-(dimethylamino)phenyl]-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl]acetamide |
| SMILES | CN(C)c1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3ccccc3N2CC(=O)NCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C32H35ClN4O2/c1-32(2)17-26-30(28(38)18-32)31(22-11-15-24(16-12-22)36(3)4)37(27-8-6-5-7-25(27)35-26)20-29(39)34-19-21-9-13-23(33)14-10-21/h5-16,31,35H,17-20H2,1-4H3,(H,34,39) |
| InChIKey | OOBNSFNXVHXQIK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.11 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|