About [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate
[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate (PubChem CID 19057744) has the molecular formula C18H22N2O2S2
and a molecular weight of 362.52 g/mol. Its IUPAC name is [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate.
Molecular Properties
| Compound Name | [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate |
| PubChem CID | 19057744 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate |
| SMILES | Cc1cccc(C)c1N1C(=O)CC(SC(=S)N2CCCCC2)C1=O |
| InChI | InChI=1S/C18H22N2O2S2/c1-12-7-6-8-13(2)16(12)20-15(21)11-14(17(20)22)24-18(23)19-9-4-3-5-10-19/h6-8,14H,3-5,9-11H2,1-2H3 |
| InChIKey | ZMRNONKHIOHPSZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate?
The IUPAC name of [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate (CID 19057744) is [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate.
What is the SMILES notation for [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate?
The canonical SMILES for [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate is Cc1cccc(C)c1N1C(=O)CC(SC(=S)N2CCCCC2)C1=O.
What is the InChIKey of [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate?
The InChIKey is ZMRNONKHIOHPSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2S2/c1-12-7-6-8-13(2)16(12)20-15(21)11-14(17(20)22)24-18(23)19-9-4-3-5-10-19/h6-8,14H,3-5,9-11H2,1-2H3.
What are the key properties of [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate?
[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate has a molecular weight of 362.52 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl] piperidine-1-carbodithioate is sourced from PubChem (CID 19057744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).