About [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate
[2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate (PubChem CID 19059660) has the molecular formula C36H26N2O3S
and a molecular weight of 566.68 g/mol. Its IUPAC name is [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate.
Molecular Properties
| Compound Name | [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate |
| PubChem CID | 19059660 |
| Molecular Formula | C36H26N2O3S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccccc2)nc1SCCC(=O)OCC(=O)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C36H26N2O3S/c37-22-32-31(24-9-3-1-4-10-24)21-33(25-11-5-2-6-12-25)38-36(32)42-18-17-35(40)41-23-34(39)27-15-16-30-28(20-27)19-26-13-7-8-14-29(26)30/h1-16,20-21H,17-19,23H2 |
| InChIKey | BOFUZNRLAZJUQW-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate?
The IUPAC name of [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate (CID 19059660) is [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate.
What is the SMILES notation for [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate?
The canonical SMILES for [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate is N#Cc1c(-c2ccccc2)cc(-c2ccccc2)nc1SCCC(=O)OCC(=O)c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate?
The InChIKey is BOFUZNRLAZJUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H26N2O3S/c37-22-32-31(24-9-3-1-4-10-24)21-33(25-11-5-2-6-12-25)38-36(32)42-18-17-35(40)41-23-34(39)27-15-16-30-28(20-27)19-26-13-7-8-14-29(26)30/h1-16,20-21H,17-19,23H2.
What are the key properties of [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate?
[2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate has a molecular weight of 566.68 g/mol, XLogP of 7.77, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(9H-fluoren-2-yl)-2-oxoethyl] 3-[(3-cyano-4,6-diphenyl-2-pyridinyl)sulfanyl]propanoate is sourced from PubChem (CID 19059660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).