About 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline
4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline (PubChem CID 19060062) has the molecular formula C18H21Cl2N3
and a molecular weight of 350.29 g/mol. Its IUPAC name is 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline.
Molecular Properties
| Compound Name | 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline |
| PubChem CID | 19060062 |
| Molecular Formula | C18H21Cl2N3 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=N/NCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C18H21Cl2N3/c1-3-23(4-2)15-10-8-14(9-11-15)12-21-22-13-16-17(19)6-5-7-18(16)20/h5-12,22H,3-4,13H2,1-2H3/b21-12+ |
| InChIKey | AUWJZHWZMSKLNT-CIAFOILYSA-N |
| XLogP | 4.96 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline?
The IUPAC name of 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline (CID 19060062) is 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline.
What is the SMILES notation for 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline?
The canonical SMILES for 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline is CCN(CC)c1ccc(/C=N/NCc2c(Cl)cccc2Cl)cc1.
What is the InChIKey of 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline?
The InChIKey is AUWJZHWZMSKLNT-CIAFOILYSA-N. The full InChI is InChI=1S/C18H21Cl2N3/c1-3-23(4-2)15-10-8-14(9-11-15)12-21-22-13-16-17(19)6-5-7-18(16)20/h5-12,22H,3-4,13H2,1-2H3/b21-12+.
What are the key properties of 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline?
4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline has a molecular weight of 350.29 g/mol, XLogP of 4.96, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-[(2,6-dichlorophenyl)methylhydrazinylidene]methyl]-N,N-diethylaniline is sourced from PubChem (CID 19060062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).