C19H18ClN3O3S — CID 19061687
propan-2-yl 4-[[2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 19061687) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is propan-2-yl 4-[[2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19061687 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | propan-2-yl 4-[[2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)CSc2nc3ccc(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H18ClN3O3S/c1-11(2)26-18(25)12-3-6-14(7-4-12)21-17(24)10-27-19-22-15-8-5-13(20)9-16(15)23-19/h3-9,11H,10H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | GAUFEKSIMAKJTQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |