C20H23ClN4O5S — CID 19061699
N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-N-(2-methyl-5-nitrophenyl)methanesulfonamide (PubChem CID 19061699) has the molecular formula C20H23ClN4O5S and a molecular weight of 466.95 g/mol. Its IUPAC name is N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-N-(2-methyl-5-nitrophenyl)methanesulfonamide.
| Compound Name | N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-N-(2-methyl-5-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 19061699 |
| Molecular Formula | C20H23ClN4O5S |
| Molecular Weight | 466.95 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-N-(2-methyl-5-nitrophenyl)methanesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(CC(=O)N1CCN(c2cccc(Cl)c2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C20H23ClN4O5S/c1-15-6-7-18(25(27)28)13-19(15)24(31(2,29)30)14-20(26)23-10-8-22(9-11-23)17-5-3-4-16(21)12-17/h3-7,12-13H,8-11,14H2,1-2H3 |
| InChIKey | CZGPDXBETQTBJF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.95 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|