C26H28FN3O5S — CID 19062210
2-[[4-[(4-fluorophenyl)methyl-methylsulfonylamino]benzoyl]amino]-N-(3-methoxypropyl)benzamide (PubChem CID 19062210) has the molecular formula C26H28FN3O5S and a molecular weight of 513.59 g/mol. Its IUPAC name is 2-[[4-[(4-fluorophenyl)methyl-methylsulfonylamino]benzoyl]amino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 2-[[4-[(4-fluorophenyl)methyl-methylsulfonylamino]benzoyl]amino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 19062210 |
| Molecular Formula | C26H28FN3O5S |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-[[4-[(4-fluorophenyl)methyl-methylsulfonylamino]benzoyl]amino]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccccc1NC(=O)c1ccc(N(Cc2ccc(F)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H28FN3O5S/c1-35-17-5-16-28-26(32)23-6-3-4-7-24(23)29-25(31)20-10-14-22(15-11-20)30(36(2,33)34)18-19-8-12-21(27)13-9-19/h3-4,6-15H,5,16-18H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | YFHCFZRPQASYSP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|