C19H24N2O3S — CID 19062395
3-[(4-methylphenyl)sulfonylamino]-N-pentan-2-ylbenzamide (PubChem CID 19062395) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylamino]-N-pentan-2-ylbenzamide.
| Compound Name | 3-[(4-methylphenyl)sulfonylamino]-N-pentan-2-ylbenzamide |
|---|---|
| PubChem CID | 19062395 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylamino]-N-pentan-2-ylbenzamide |
| SMILES | CCCC(C)NC(=O)c1cccc(NS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-4-6-15(3)20-19(22)16-7-5-8-17(13-16)21-25(23,24)18-11-9-14(2)10-12-18/h5,7-13,15,21H,4,6H2,1-3H3,(H,20,22) |
| InChIKey | CKWHIJDYKQYWKR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |