About methoxymethane;propane-1,2-diol;propan-2-one
methoxymethane;propane-1,2-diol;propan-2-one (PubChem CID 19063264) has the molecular formula C8H20O4
and a molecular weight of 180.24 g/mol. Its IUPAC name is methoxymethane;propane-1,2-diol;propan-2-one.
Molecular Properties
| Compound Name | methoxymethane;propane-1,2-diol;propan-2-one |
| PubChem CID | 19063264 |
| Molecular Formula | C8H20O4 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | methoxymethane;propane-1,2-diol;propan-2-one |
| SMILES | CC(C)=O.CC(O)CO.COC |
| InChI | InChI=1S/C3H8O2.C3H6O.C2H6O/c1-3(5)2-4;1-3(2)4;1-3-2/h3-5H,2H2,1H3;1-2H3;1-2H3 |
| InChIKey | YAJAQYVGWXMLQQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methoxymethane;propane-1,2-diol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;propane-1,2-diol;propan-2-one?
The IUPAC name of methoxymethane;propane-1,2-diol;propan-2-one (CID 19063264) is methoxymethane;propane-1,2-diol;propan-2-one.
What is the SMILES notation for methoxymethane;propane-1,2-diol;propan-2-one?
The canonical SMILES for methoxymethane;propane-1,2-diol;propan-2-one is CC(C)=O.CC(O)CO.COC.
What is the InChIKey of methoxymethane;propane-1,2-diol;propan-2-one?
The InChIKey is YAJAQYVGWXMLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.C3H6O.C2H6O/c1-3(5)2-4;1-3(2)4;1-3-2/h3-5H,2H2,1H3;1-2H3;1-2H3.
What are the key properties of methoxymethane;propane-1,2-diol;propan-2-one?
methoxymethane;propane-1,2-diol;propan-2-one has a molecular weight of 180.24 g/mol, XLogP of 0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;propane-1,2-diol;propan-2-one is sourced from PubChem (CID 19063264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).