(2,3-dichloro-6-chlorooxyphenyl) hypochlorite

C6H2Cl4O2 — CID 19063274

IUPAC(2,3-dichloro-6-chlorooxyphenyl) hypochlorite
SMILESClOc1ccc(Cl)c(Cl)c1OCl
InChIInChI=1S/C6H2Cl4O2/c7-3-1-2-4(11-9)6(12-10)5(3)8/h1-2H
InChIKeyHESZXZYLWCFXID-UHFFFAOYSA-N
MW247.89 g/mol
LogP4.06
Rot. Bonds2

About (2,3-dichloro-6-chlorooxyphenyl) hypochlorite

(2,3-dichloro-6-chlorooxyphenyl) hypochlorite (PubChem CID 19063274) has the molecular formula C6H2Cl4O2 and a molecular weight of 247.89 g/mol. Its IUPAC name is (2,3-dichloro-6-chlorooxyphenyl) hypochlorite.

Molecular Properties

Compound Name(2,3-dichloro-6-chlorooxyphenyl) hypochlorite
PubChem CID19063274
Molecular FormulaC6H2Cl4O2
Molecular Weight247.89 g/mol
Exact Mass245.88
IUPAC Name(2,3-dichloro-6-chlorooxyphenyl) hypochlorite
SMILESClOc1ccc(Cl)c(Cl)c1OCl
InChIInChI=1S/C6H2Cl4O2/c7-3-1-2-4(11-9)6(12-10)5(3)8/h1-2H
InChIKeyHESZXZYLWCFXID-UHFFFAOYSA-N
XLogP4.06
TPSA18.46 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.89
LogP ≤ 54.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (2,3-dichloro-6-chlorooxyphenyl) hypochlorite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,3-dichloro-6-chlorooxyphenyl) hypochlorite?
The IUPAC name of (2,3-dichloro-6-chlorooxyphenyl) hypochlorite (CID 19063274) is (2,3-dichloro-6-chlorooxyphenyl) hypochlorite.
What is the SMILES notation for (2,3-dichloro-6-chlorooxyphenyl) hypochlorite?
The canonical SMILES for (2,3-dichloro-6-chlorooxyphenyl) hypochlorite is ClOc1ccc(Cl)c(Cl)c1OCl.
What is the InChIKey of (2,3-dichloro-6-chlorooxyphenyl) hypochlorite?
The InChIKey is HESZXZYLWCFXID-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl4O2/c7-3-1-2-4(11-9)6(12-10)5(3)8/h1-2H.
What are the key properties of (2,3-dichloro-6-chlorooxyphenyl) hypochlorite?
(2,3-dichloro-6-chlorooxyphenyl) hypochlorite has a molecular weight of 247.89 g/mol, XLogP of 4.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dichloro-6-chlorooxyphenyl) hypochlorite is sourced from PubChem (CID 19063274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).