C6H5F9O — CID 19063490
1,1,1,2,3,3-hexafluoro-4-(2,2,2-trifluoroethoxy)butane (PubChem CID 19063490) has the molecular formula C6H5F9O and a molecular weight of 264.09 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-4-(2,2,2-trifluoroethoxy)butane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-4-(2,2,2-trifluoroethoxy)butane |
|---|---|
| PubChem CID | 19063490 |
| Molecular Formula | C6H5F9O |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-4-(2,2,2-trifluoroethoxy)butane |
| SMILES | FC(C(F)(F)F)C(F)(F)COCC(F)(F)F |
| InChI | InChI=1S/C6H5F9O/c7-3(6(13,14)15)4(8,9)1-16-2-5(10,11)12/h3H,1-2H2 |
| InChIKey | LYRDESIPRCGUIJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |