About 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride
6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride (PubChem CID 19063762) has the molecular formula C16H17ClN2O2S
and a molecular weight of 336.84 g/mol. Its IUPAC name is 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride.
Molecular Properties
| Compound Name | 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride |
| PubChem CID | 19063762 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride |
| SMILES | CCOc1cc2ncc(-c3ccsc3)nc2cc1OCC.Cl |
| InChI | InChI=1S/C16H16N2O2S.ClH/c1-3-19-15-7-12-13(8-16(15)20-4-2)18-14(9-17-12)11-5-6-21-10-11;/h5-10H,3-4H2,1-2H3;1H |
| InChIKey | ARTFEMFBGWBACJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride?
The IUPAC name of 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride (CID 19063762) is 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride.
What is the SMILES notation for 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride?
The canonical SMILES for 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride is CCOc1cc2ncc(-c3ccsc3)nc2cc1OCC.Cl.
What is the InChIKey of 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride?
The InChIKey is ARTFEMFBGWBACJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S.ClH/c1-3-19-15-7-12-13(8-16(15)20-4-2)18-14(9-17-12)11-5-6-21-10-11;/h5-10H,3-4H2,1-2H3;1H.
What are the key properties of 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride?
6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride has a molecular weight of 336.84 g/mol, XLogP of 4.58, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-diethoxy-2-thiophen-3-ylquinoxaline;hydrochloride is sourced from PubChem (CID 19063762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).